missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,6-Di-tert-butyl-4-methylphenol, 99%, ACROS Organics™
$43.17 - $97.18
Chemical Identifiers
| CAS | 128-37-0 |
|---|---|
| Molecular Formula | C15H24O |
| Molecular Weight (g/mol) | 220.35 |
| MDL Number | MFCD00011644 |
| InChI Key | NLZUEZXRPGMBCV-UHFFFAOYSA-N |
| Synonym | 2,6-di-t-butyl-4-methylphenol, 2,6-di-tert-butyl-4-methylphenol, 2,6-di-tert-butyl-p-cresol, bht, butylated hydroxytoluene, butylhydroxytoluene, dbpc, dibunol, ionol, stavox |
| PubChem CID | 31404 |
| ChEBI | CHEBI:34247 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC112992500
|
Thermo Fisher Scientific
112992500 |
250g | Plastic bottle |
Each for $43.17
|
|
AC112990010
|
Fisher Scientific Acros
112990010 |
1kg | Plastic bottle |
Each for $97.18
|
|
AC112990050
|
Thermo Fisher Scientific
AC112990050 |
5kg | Plastic drum |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 128-37-0 | |
| 220.35 | |
| NLZUEZXRPGMBCV-UHFFFAOYSA-N | |
| 31404 | |
| 2,6-ditert-butyl-4-methylphenol |
| C15H24O | |
| MFCD00011644 | |
| 2,6-di-t-butyl-4-methylphenol, 2,6-di-tert-butyl-4-methylphenol, 2,6-di-tert-butyl-p-cresol, bht, butylated hydroxytoluene, butylhydroxytoluene, dbpc, dibunol, ionol, stavox | |
| CHEBI:34247 | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Specifications
| 127°C | |
| Plastic bottle | |
| 0.12% max. (K.F.) | |
| White | |
| 250g | |
| 98.5 | |
| 98.5% min. (GC) | |
| [(CH3)3C]2C6H2(CH3)OH | |
| 06, III, 2073 | |
| 15, 1550 | |
| Solubility in water: insoluble. Other solubilities: freely soluble in toluene, soluble in methanol, ethanol, isopropanol, acetone, benzene, methyl ethyl ketone, petroleum ether,, cellowolve and most other hydrocarbon solvents | |
| CC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C | |
| 220.35 | |
| CHEBI:34247 | |
| Crystals | |
| 2,6-Di-tert-butyl-4-methylphenol |
| Authentic | |
| 3.47 mm2/s (0°C) | |
| 265.0°C | |
| 69.0°C to 71.0°C | |
| 128-37-0 | |
| 100.0 | |
| C15H24O | |
| MFCD00011644 | |
| 15,113 | |
| 2,6-di-t-butyl-4-methylphenol, 2,6-di-tert-butyl-4-methylphenol, 2,6-di-tert-butyl-p-cresol, bht, butylated hydroxytoluene, butylhydroxytoluene, dbpc, dibunol, ionol, stavox | |
| NLZUEZXRPGMBCV-UHFFFAOYSA-N | |
| 2,6-ditert-butyl-4-methylphenol | |
| 31404 | |
| 220.35 | |
| 99% |
Safety and Handling
GHS H Statement
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Avoid release to the environment.
Collect spillage.
Dispose of contents/container to an approved waste disposal plant.
GHS Signal Word: Warning
EINECSNumber : 204-881-4