missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene (purified by sublimation) 99.0+%, TCI America™
Supplier: TCI America B42215G
Specifications
| 2,5-Bis(5-tert-butyl-2-benzoxazolyl)thiophene (purified by sublimation) | |
| 202°C | |
| MFCD00005774 | |
| bbot, 2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene, uvitex ob, 2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene, bbot 150, 2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene, benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl, unii-w7ur9129gp, fluorescent brightener 184, 2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole | |
| CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C | |
| 430.566 | |
| 430.57 | |
| Crystalline Powder |
| 7128-64-5 | |
| C26H26N2O2S | |
| 5 g | |
| AIXZBGVLNVRQSS-UHFFFAOYSA-N | |
| 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole | |
| 292429 | |
| ≥99.0% (HPLC,N) |
Chemical Identifiers
| 7128-64-5 | |
| 430.566 | |
| AIXZBGVLNVRQSS-UHFFFAOYSA-N | |
| 292429 | |
| CC(C)(C)C1=CC2=C(C=C1)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=CC(=C5)C(C)(C)C |
| C26H26N2O2S | |
| MFCD00005774 | |
| bbot, 2,5-bis 5-tert-butyl-2-benzoxazolyl thiophene, uvitex ob, 2,5-bis 5-tert-butyl benzo d oxazol-2-yl thiophene, bbot 150, 2,5-bis 5-tert-butylbenzoxazol-2-yl thiophene, benzoxazole, 2,2'-2,5-thiophenediyl bis 5-1,1-dimethylethyl, unii-w7ur9129gp, fluorescent brightener 184, 2,2'-2,5-thiophenediyl bis 5-tert-butylbenzoxazole | |
| 5-tert-butyl-2-[5-(5-tert-butyl-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazole |
Safety and Handling
EINECSNumber : (5)-3934
RTECSNumber : DM4888332
TSCA : Yes