missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![2-[4-(Bromomethyl)phenyl]propionic Acid 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-111128-12-2.jpg-650.jpg)
![2-[4-(Bromomethyl)phenyl]propionic Acid 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
2-[4-(Bromomethyl)phenyl]propionic Acid 98.0+%, TCI America™
Supplier: TCI America B210125G
Specifications
| 2-[4-(Bromomethyl)phenyl]propionic Acid | |
| 125°C | |
| MFCD02093445 | |
| 2-4-bromomethyl phenyl propanoic acid, 2-4-bromomethyl phenyl propionic acid, 2-4-bromomethyl phenylpropionic acid, 2-4-bromomethyl-phenyl-propionic acid, 4-bromomethyl hydratropic acid, 2-4-bromomethyl phenyl propanic acid, 2-p-bromomethyl phenyl propionic acid, 2-4'-bromomethylphenyl propionic acid, 2-4-bromomethyl phenylproplonic acid | |
| CC(C1=CC=C(C=C1)CBr)C(=O)O | |
| 243.1 | |
| 243.10 | |
| Crystalline Powder |
| 111128-12-2 | |
| C10H11BrO2 | |
| 25 g | |
| QQXBRVQJMKBAOZ-UHFFFAOYSA-N | |
| 2-[4-(bromomethyl)phenyl]propanoic acid | |
| 2733978 | |
| ≥98.0% (T) |
Chemical Identifiers
| 111128-12-2 | |
| 243.1 | |
| QQXBRVQJMKBAOZ-UHFFFAOYSA-N | |
| 2733978 | |
| CC(C1=CC=C(C=C1)CBr)C(=O)O |
| C10H11BrO2 | |
| MFCD02093445 | |
| 2-4-bromomethyl phenyl propanoic acid, 2-4-bromomethyl phenyl propionic acid, 2-4-bromomethyl phenylpropionic acid, 2-4-bromomethyl-phenyl-propionic acid, 4-bromomethyl hydratropic acid, 2-4-bromomethyl phenyl propanic acid, 2-p-bromomethyl phenyl propionic acid, 2-4'-bromomethylphenyl propionic acid, 2-4-bromomethyl phenylproplonic acid | |
| 2-[4-(bromomethyl)phenyl]propanoic acid |
Safety and Handling
TSCA : Yes