missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,4,4'-Trichloro-2'-hydroxydiphenyl Ether 98.0+%, TCI America™
Supplier: TCI America T1872500G
Specifications
| 2,4,4′-Trichloro-2′-hydroxydiphenyl Ether | |
| 57°C | |
| 290°C | |
| MFCD00800992 | |
| 3077 | |
| XEFQLINVKFYRCS-UHFFFAOYSA-N | |
| 5-chloro-2-(2,4-dichlorophenoxy)phenol | |
| 5564 | |
| 289.54 | |
| Crystalline Powder |
| 3380-34-5 | |
| White | |
| C12H7Cl3O2 | |
| 500 g | |
| triclosan, 5-chloro-2-2,4-dichlorophenoxy phenol, irgasan, 2,4,4'-trichloro-2'-hydroxydiphenyl ether, cloxifenolum, triclosanum, irgasan dp300, stri-dex face wash, aquasept, sapoderm | |
| C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl | |
| 289.536 | |
| CHEBI:164200 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 3380-34-5 | |
| 289.536 | |
| XEFQLINVKFYRCS-UHFFFAOYSA-N | |
| 5564 | |
| 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| C12H7Cl3O2 | |
| MFCD00800992 | |
| triclosan, 5-chloro-2-2,4-dichlorophenoxy phenol, irgasan, 2,4,4'-trichloro-2'-hydroxydiphenyl ether, cloxifenolum, triclosanum, irgasan dp300, stri-dex face wash, aquasept, sapoderm | |
| CHEBI:164200 | |
| C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl |
Safety and Handling
EINECSNumber : (9)-0381&(9)-0922
RTECSNumber : KO1100000
TSCA : Yes