missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] 95.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-77-62-3.jpg-650.jpg)
![2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] 95.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
2,2'-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] 95.0+%, TCI America™
Supplier: TCI America M130125G
Specifications
| 2,2′-Methylenebis[6-(1-methylcyclohexyl)-p-cresol] | |
| 138°C | |
| MFCD00151797 | |
| 2,2'-methylenebis 6-1-methylcyclohexyl-p-cresol, ionox wsp, nonox wsp, bisalkofen mtsp, unii-7tir91vdi9, 7tir91vdi9, p-cresol, 2,2'-methylenebis 6-1-methylcyclohexyl, 2,2'-methylenebis 4-methyl-6-1-methylcyclohexyl phenol | |
| CC1=CC(=C(O)C(CC2=C(O)C(=CC(C)=C2)C2(C)CCCCC2)=C1)C1(C)CCCCC1 | |
| 420.64 | |
| 420.64 | |
| Crystalline Powder |
| 77-62-3 | |
| C29H40O2 | |
| 25 g | |
| PHXLONCQBNATSL-UHFFFAOYSA-N | |
| 2-{[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl}-4-methyl-6-(1-methylcyclohexyl)phenol | |
| 6486 | |
| ≥95.0% (T) |
Chemical Identifiers
| 77-62-3 | |
| 420.64 | |
| PHXLONCQBNATSL-UHFFFAOYSA-N | |
| 6486 | |
| CC1=CC(=C(O)C(CC2=C(O)C(=CC(C)=C2)C2(C)CCCCC2)=C1)C1(C)CCCCC1 |
| C29H40O2 | |
| MFCD00151797 | |
| 2,2'-methylenebis 6-1-methylcyclohexyl-p-cresol, ionox wsp, nonox wsp, bisalkofen mtsp, unii-7tir91vdi9, 7tir91vdi9, p-cresol, 2,2'-methylenebis 6-1-methylcyclohexyl, 2,2'-methylenebis 4-methyl-6-1-methylcyclohexyl phenol | |
| 2-{[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methyl}-4-methyl-6-(1-methylcyclohexyl)phenol |
Safety and Handling
EINECSNumber : (4)-0888
RTECSNumber : SM0400000
TSCA : Yes