Learn More
2-(2-Butoxyethoxy)ethanol, 99+%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC149710025
Specifications
| 2-(2-Butoxyethoxy)ethanol | |
| 100°C | |
| 1.4310 to 1.4330 | |
| 6.16 mPa.s (20°C) | |
| -68.0°C | |
| 99+% | |
| 99.0 | |
| 99% min. (GC) | |
| CH3(CH2)3OCH2CH2OCH2CH2OH | |
| 15,3133 | |
| Solubility in water: soluble. Other solubilities: miscible with oils, miscible with most common organic solvents | |
| CCCCOCCOCCO | |
| 162.23 | |
| 162.23 |
| 0.9550g/mL | |
| Glass bottle | |
| 0.955 | |
| 231.0°C | |
| 2.5L | |
| 112-34-5 | |
| 100.0 | |
| C8H18O3 | |
| 01,IV,2394 | |
| 2-2-butoxyethoxy ethanol, butoxydiglycol, butoxyethoxyethanol, butyl carbitol, butyl diglycol, butyl digol, butyldiglycol, diethylene glycol butyl ether, diethylene glycol monobutyl ether, ethanol, 2-2-butoxyethoxy | |
| OAYXUHPQHDHDDZ-UHFFFAOYSA-N | |
| 2-(2-butoxyethoxy)ethanol | |
| 8177 | |
| 99+% |
Chemical Identifiers
| 112-34-5 | |
| 162.23 | |
| 2-2-butoxyethoxy ethanol, butoxydiglycol, butoxyethoxyethanol, butyl carbitol, butyl diglycol, butyl digol, butyldiglycol, diethylene glycol butyl ether, diethylene glycol monobutyl ether, ethanol, 2-2-butoxyethoxy | |
| 2-(2-butoxyethoxy)ethanol |
| C8H18O3 | |
| OAYXUHPQHDHDDZ-UHFFFAOYSA-N | |
| 8177 | |
| CCCCOCCOCCO |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
GHS P Statement:
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning
EINECSNumber : 203-961-6