missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2-Bis(4-hydroxy-3-methylphenyl)propane 98.0+%, TCI America™
Supplier: TCI America B156725G
Specifications
| 2,2-Bis(4-hydroxy-3-methylphenyl)propane | |
| 139°C | |
| C17H20O2 | |
| 25 g | |
| YMTYZTXUZLQUSF-UHFFFAOYSA-N | |
| 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol | |
| 6620 | |
| 256.35 | |
| Crystalline Powder |
| 79-97-0 | |
| White | |
| MFCD00002232 | |
| 4,4′C-Isopropylidenedi-o-cresol | |
| CC1=C(C=CC(=C1)C(C)(C)C2=CC(=C(C=C2)O)C)O | |
| 256.345 | |
| CHEBI:34321 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 79-97-0 | |
| 256.345 | |
| YMTYZTXUZLQUSF-UHFFFAOYSA-N | |
| CHEBI:34321 | |
| CC1=C(C=CC(=C1)C(C)(C)C2=CC(=C(C=C2)O)C)O |
| C17H20O2 | |
| MFCD00002232 | |
| 6620 | |
| 4-[2-(4-hydroxy-3-methylphenyl)propan-2-yl]-2-methylphenol |
Safety and Handling
EINECSNumber : (4)-1696
RTECSNumber : GP1750000
TSCA : Yes