missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2-Bis(4-carboxyphenyl)hexafluoropropane 98.0+%, TCI America™
Supplier: TCI America B140125G
Specifications
| 2,2-Bis(4-carboxyphenyl)hexafluoropropane | |
| 275°C | |
| C17H10F6O4 | |
| 25 g | |
| PHQYMDAUTAXXFZ-UHFFFAOYSA-N | |
| 4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid | |
| 633763 | |
| ≥98.0% (GC,T) |
| 1171-47-7 | |
| White | |
| MFCD00040931 | |
| 2,2-bis 4-carboxyphenyl hexafluoropropane, 4,4'-perfluoropropane-2,2-diyl dibenzoic acid, benzoic acid, 4,4'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis, 4-2-4-carboxyphenyl-1,1,1,3,3,3-hexafluoropropan-2-yl benzoic acid, 4,4'-hexafluoroisopropylidene bis benzoic acid, 4-1-4-carboxyphenyl-2,2,2-trifluoro-1-trifluoromethyl ethyl benzoic acid, acmc-1c1gj, 2,2-bis-4-carboxyphenyl hexafluoropropane | |
| C1=CC(=CC=C1C(=O)O)C(C2=CC=C(C=C2)C(=O)O)(C(F)(F)F)C(F)(F)F | |
| 392.253 | |
| 392.25 | |
| Crystalline Powder |
Chemical Identifiers
| 1171-47-7 | |
| 392.253 | |
| PHQYMDAUTAXXFZ-UHFFFAOYSA-N | |
| 633763 | |
| C1=CC(=CC=C1C(=O)O)C(C2=CC=C(C=C2)C(=O)O)(C(F)(F)F)C(F)(F)F |
| C17H10F6O4 | |
| MFCD00040931 | |
| 2,2-bis 4-carboxyphenyl hexafluoropropane, 4,4'-perfluoropropane-2,2-diyl dibenzoic acid, benzoic acid, 4,4'-2,2,2-trifluoro-1-trifluoromethyl ethylidene bis, 4-2-4-carboxyphenyl-1,1,1,3,3,3-hexafluoropropan-2-yl benzoic acid, 4,4'-hexafluoroisopropylidene bis benzoic acid, 4-1-4-carboxyphenyl-2,2,2-trifluoro-1-trifluoromethyl ethyl benzoic acid, acmc-1c1gj, 2,2-bis-4-carboxyphenyl hexafluoropropane | |
| 4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
Safety and Handling
TSCA : Yes