Learn More
2,2,3,3,4,4,4-Heptafluoro-1-butanol, 95%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC243890500
Specifications
| 2,2,3,3,4,4,4-Heptafluoro-1-butanol | |
| 25°C | |
| Glass bottle | |
| 1.6 | |
| White to Beige | |
| 375-01-9 | |
| 100.0 | |
| C4H3F7O | |
| MFCD00004674 | |
| 1,1-dihydroperfluorobutanol | |
| WXJFKAZDSQLPBX-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,4-heptafluorobutan-1-ol | |
| 9776 | |
| Crystalline Powder |
| 1.6000g/mL | |
| Authentic | |
| 1.2920 to 1.294 | |
| 96°C to 97°C | |
| 50g | |
| 94.0 | |
| 95% | |
| CF3CF2CF2CH2OH | |
| 01, 1547 | |
| Solubility in water: slightly soluble | |
| C(C(C(C(F)(F)F)(F)F)(F)F)O | |
| 200.06 | |
| 200.06 | |
| ≥94% (GC) |
Chemical Identifiers
| 375-01-9 | |
| 200.06 | |
| WXJFKAZDSQLPBX-UHFFFAOYSA-N | |
| 9776 | |
| C(C(C(C(F)(F)F)(F)F)(F)F)O |
| C4H3F7O | |
| MFCD00004674 | |
| 1,1-dihydroperfluorobutanol | |
| 2,2,3,3,4,4,4-heptafluorobutan-1-ol |
Safety and Handling
GHS H Statement:
May cause respiratory irritation.
Causes serious eye irritation.
Causes skin irritation.
Flammable liquid and vapor.
GHS P Statement:
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
Keep away from heat/sparks/open flames/hot surfaces. - No smoking.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Warning