missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1H,1H,2H,2H-Nonafluorohexyl Methacrylate (stabilized with MEHQ) 98.0+%, TCI America™
Supplier: TCI America N10145G
Specifications
| 1H,1H,2H,2H-Nonafluorohexyl Methacrylate (stabilized with MEHQ) | |
| Colorless | |
| MFCD00236094 | |
| Methacrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester, 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Ester | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F | |
| 332.17 | |
| 332.17 | |
| Liquid |
| 1799-84-4 | |
| C10H9F9O2 | |
| 5 g | |
| TYNRPOFACABVSI-UHFFFAOYSA-N | |
| 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylprop-2-enoate | |
| 74534 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 1799-84-4 | |
| 332.17 | |
| TYNRPOFACABVSI-UHFFFAOYSA-N | |
| 74534 | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| C10H9F9O2 | |
| MFCD00236094 | |
| Methacrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester, 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Ester | |
| 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2-methylprop-2-enoate |
Safety and Handling
TSCA : Yes