missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1H,1H,2H,2H-Nonafluorohexyl Acrylate (stabilized with TBC) 98.0+%, TCI America™
Supplier: TCI America N11075G
Specifications
| 1H,1H,2H,2H-Nonafluorohexyl Acrylate (stabilized with TBC) | |
| Yellow | |
| MFCD00236104 | |
| 3272 | |
| GYUPEJSTJSFVRR-UHFFFAOYSA-N | |
| 3,3,4,4,5,5,6,6,6-nonafluorohexyl prop-2-enoate | |
| 104247 | |
| ≥98.0% (GC) |
| 52591-27-2 | |
| C9H7F9O2 | |
| 5 g | |
| Acrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester, 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Acrylate, Acrylic Acid 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Ester | |
| FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C | |
| 318.14 | |
| 318.14 | |
| Liquid |
Chemical Identifiers
| 52591-27-2 | |
| 318.14 | |
| GYUPEJSTJSFVRR-UHFFFAOYSA-N | |
| 104247 | |
| FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOC(=O)C=C |
| C9H7F9O2 | |
| MFCD00236104 | |
| Acrylic Acid 1H,1H,2H,2H-Nonafluorohexyl Ester, 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Acrylate, Acrylic Acid 3,3,4,4,5,5,6,6,6-Nonafluorohexyl Ester | |
| 3,3,4,4,5,5,6,6,6-nonafluorohexyl prop-2-enoate |
Safety and Handling
EINECSNumber : (2)-4056
TSCA : Yes