missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-O-n-Octyl-β-D-glucopyranoside, 98%, ACROS Organics™
Manufacturer: Fisher Scientific Acros 230340010
Specifications
| (5% aq. soln.) clear, colorless | |
| Authentic | |
| − 32.00 (20.00°C c=5,water) | |
| White | |
| 1g | |
| 97.5 | |
| 97.5% min. (ELSD) (HPLC) | |
| MFCD00063288 | |
| 2r,3s,4s,5r,6r-2-hydroxymethyl-6-octyloxy tetrahydro-2h-pyran-3,4,5-triol, b-octylglucoside, n-octyl glucoside, n-octyl-beta-d-glucoside, octyl b-d-glucopyranoside, octyl beta-d-glucopyranoside, octyl beta-d-glucoside, octyl glucoside, octyl-beta-d-glucopyranoside, unii-v109wut6rl | |
| HEGSGKPQLMEBJL-RKQHYHRCSA-N | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol | |
| 62852 | |
| Crystalline Powder and Chunks |
| 1-O-n-Octyl-β-D-glucopyranoside | |
| Glass bottle | |
| -32 | |
| 105°C | |
| 29836-26-8 | |
| 100.0 | |
| C14H28O6 | |
| 15, 6857 | |
| (10% in water) Clear to slightly hazy colorless to light yellow | |
| CCCCCCCCOC1C(C(C(C(O1)CO)O)O)O | |
| 292.36 | |
| 292.36 | |
| 98% |
Chemical Identifiers
| 29836-26-8 | |
| 292.36 | |
| HEGSGKPQLMEBJL-RKQHYHRCSA-N | |
| 62852 | |
| CCCCCCCCOC1C(C(C(C(O1)CO)O)O)O |
| C14H28O6 | |
| MFCD00063288 | |
| 2r,3s,4s,5r,6r-2-hydroxymethyl-6-octyloxy tetrahydro-2h-pyran-3,4,5-triol, b-octylglucoside, n-octyl glucoside, n-octyl-beta-d-glucoside, octyl b-d-glucopyranoside, octyl beta-d-glucopyranoside, octyl beta-d-glucoside, octyl glucoside, octyl-beta-d-glucopyranoside, unii-v109wut6rl | |
| (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octoxyoxane-3,4,5-triol |
Safety and Handling
EINECSNumber : 249-887-8