missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Naphthoyl chloride, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 270380100
Specifications
| 1-Naphthoyl chloride | |
| >110°C | |
| Glass bottle | |
| 1.26 | |
| White | |
| 10g | |
| 98.5 | |
| 98.5% min. (GC) | |
| MFCD00004002 | |
| .alpha.-naphthoyl chloride, 1-chlorocarbonyl naphthalene, 1-naphthalenecarbonyl chloride, 1-naphthoic acid chloride, 1-naphthoyl chloride, 1-naphthoylchloride, alpha-naphthoyl chloride, naphthalenecarbonyl chloride, naphthoyl chloride, naphthoylchloride | |
| NSNPSJGHTQIXDO-UHFFFAOYSA-N | |
| naphthalene-1-carbonyl chloride | |
| 70146 | |
| Powder, Flakes or Crystals |
| 1.2600g/mL | |
| Authentic | |
| 1.6515 to 1.6535 | |
| 190°C (35.0mmHg) | |
| 16°C to 19°C | |
| 879-18-5 | |
| 100.0 | |
| C11H7ClO | |
| 09, 648 | |
| Solubility in water: decomposes | |
| C1=CC=C2C(=C1)C=CC=C2C(=O)Cl | |
| 190.63 | |
| 190.63 | |
| 99% |
Chemical Identifiers
| 879-18-5 | |
| 190.63 | |
| NSNPSJGHTQIXDO-UHFFFAOYSA-N | |
| 70146 | |
| C1=CC=C2C(=C1)C=CC=C2C(=O)Cl |
| C11H7ClO | |
| MFCD00004002 | |
| .alpha.-naphthoyl chloride, 1-chlorocarbonyl naphthalene, 1-naphthalenecarbonyl chloride, 1-naphthoic acid chloride, 1-naphthoyl chloride, 1-naphthoylchloride, alpha-naphthoyl chloride, naphthalenecarbonyl chloride, naphthoyl chloride, naphthoylchloride | |
| naphthalene-1-carbonyl chloride |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 212-903-9