missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Iodo-4-nitrobenzene, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 122381000
Specifications
| 1-Iodo-4-nitrobenzene | |
| Authentic | |
| 289.0°C (772.0 mmHg) | |
| 171.0°C to 173.0°C | |
| 99% | |
| 98.5 | |
| 98.5% min. (GC) | |
| IC6H4NO2 | |
| 05, 253 | |
| Solubility in water: insoluble | |
| C1=CC(=CC=C1[N+](=O)[O-])I | |
| 249.01 | |
| 249.01 | |
| 99% |
| 100°C | |
| Glass bottle | |
| Brown | |
| 100g | |
| 636-98-6 | |
| 100.0 | |
| C6H4INO2 | |
| MFCD00007299 | |
| 1-iodo-4-nitro-benzene, 4-iodo-1-nitrobenzene, 4-iodo-nitrobenzene, 4-iodonitrobenzene, 4-nitro-1-iodobenzene, 4-nitroiodobenzene, benzene, 1-iodo-4-nitro, p-iodonitrobenzene, p-nitroiodobenzene, p-nitrophenyl iodide | |
| SCCCFNJTCDSLCY-UHFFFAOYSA-N | |
| 1-iodo-4-nitrobenzene | |
| 12495 | |
| Powder |
Chemical Identifiers
| 636-98-6 | |
| 249.01 | |
| SCCCFNJTCDSLCY-UHFFFAOYSA-N | |
| 12495 | |
| C1=CC(=CC=C1[N+](=O)[O-])I |
| C6H4INO2 | |
| MFCD00007299 | |
| 1-iodo-4-nitro-benzene, 4-iodo-1-nitrobenzene, 4-iodo-nitrobenzene, 4-iodonitrobenzene, 4-nitro-1-iodobenzene, 4-nitroiodobenzene, benzene, 1-iodo-4-nitro, p-iodonitrobenzene, p-nitroiodobenzene, p-nitrophenyl iodide | |
| 1-iodo-4-nitrobenzene |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
May cause respiratory irritation.
GHS P Statement
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
IF ON SKIN: Wash with plenty of soap and water.
Do not breathe dust/fume/gas/mist/vapor
GHS Signal Word: Warning
EINECSNumber : 211-272-7
TSCA : TSCA