missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Fluoro-2-nitrobenzene, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 119480100
Specifications
| 1-Fluoro-2-nitrobenzene | |
| 94°C | |
| Glass bottle | |
| 1.335 | |
| Brown to Yellow | |
| 10mL | |
| 98.5 | |
| 98.5% min. (GC) | |
| FC6H4NO2 | |
| 05, 241 | |
| Solubility in water: immiscible | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F | |
| 141.1 | |
| 141.1 | |
| 99% |
| 1.3350g/mL | |
| Authentic | |
| 1.5307 to 1.5327 | |
| 215°C | |
| -9°C to 6°C | |
| 1493-27-2 | |
| 100.0 | |
| C6H4FNO2 | |
| MFCD00007048 | |
| 1-fluoro-2-nitro-benzene | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 1-fluoro-2-nitrobenzene | |
| 73895 | |
| Liquid |
Chemical Identifiers
| 1493-27-2 | |
| 141.1 | |
| PWKNBLFSJAVFAB-UHFFFAOYSA-N | |
| 73895 | |
| C1=CC=C(C(=C1)[N+](=O)[O-])F |
| C6H4FNO2 | |
| MFCD00007048 | |
| 1-fluoro-2-nitro-benzene | |
| 1-fluoro-2-nitrobenzene |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Fatal in contact with skin.
Causes serious eye irritation.
May cause damage to organs through prolonged or repeated exposure.
Causes skin irritation.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
Immediately call a POISON CENTER or doctor/physician.
If skin irritation occurs: Get medical
GHS Signal Word: Danger
EINECSNumber : 216-088-