missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Benzyl D-Aspartate 98.0+%, TCI America™
Supplier: TCI America B29931G
Specifications
| 1-Benzyl D-Aspartate | |
| 176°C | |
| C11H13NO4 | |
| 1-benzyl d-aspartate, d-aspartic acid alpha-benzyl ester, 3r-3-amino-4-oxo-4-phenylmethoxybutanoic acid, 3r-3-amino-4-benzyloxy-4-oxobutanoic acid, 1-benzyld-aspartate, d-aspartic acid, a-benzyl ester, d-aspartic acid 1-benzyl ester, d-aspartic acid, 1-phenylmethyl ester | |
| C1=CC=C(C=C1)COC(=O)C(CC(=O)O)N | |
| 223.228 | |
| 223.23 | |
| Crystalline Powder |
| 79337-40-9 | |
| White | |
| 1 g | |
| NJSRYBIBUXBNSW-SECBINFHSA-N | |
| (3R)-3-amino-4-oxo-4-phenylmethoxybutanoic acid | |
| 6995008 | |
| ≥98.0% (HPLC,T) |
Chemical Identifiers
| 79337-40-9 | |
| 223.228 | |
| 1-benzyl d-aspartate, d-aspartic acid alpha-benzyl ester, 3r-3-amino-4-oxo-4-phenylmethoxybutanoic acid, 3r-3-amino-4-benzyloxy-4-oxobutanoic acid, 1-benzyld-aspartate, d-aspartic acid, a-benzyl ester, d-aspartic acid 1-benzyl ester, d-aspartic acid, 1-phenylmethyl ester | |
| (3R)-3-amino-4-oxo-4-phenylmethoxybutanoic acid |
| C11H13NO4 | |
| NJSRYBIBUXBNSW-SECBINFHSA-N | |
| 6995008 | |
| C1=CC=C(C=C1)COC(=O)C(CC(=O)O)N |
Safety and Handling
TSCA : No