missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,8-Dihydroxyanthraquinone, 95%, Acros Organics™
Manufacturer: Acros Organics 114835000
Specifications
| 1, 8-Dihydroxyanthraquinone | |
| Brown or Brown-Orange | |
| 500g | |
| 117-10-2 | |
| 100.0 | |
| Glass bottle | |
| 1% max. | |
| 95% | |
| MFCD00001211 | |
| 15, 2814 | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 1,8-dihydroxyanthracene-9,10-dione | |
| 2950 | |
| 240.21 |
| >200°C | |
| 190.0°C to 195.0°C | |
| 90-95% | |
| 90.0 | |
| Authentic | |
| 1% max. | |
| 95% | |
| C14H8O4 | |
| 08, 458 | |
| Danthron | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O | |
| 240.214 | |
| CHEBI:3682 | |
| Powder |
Chemical Identifiers
| 117-10-2 | |
| 240.214 | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 2950 | |
| 1,8-dihydroxyanthracene-9,10-dione |
| C14H8O4 | |
| MFCD00001211 | |
| Danthron | |
| CHEBI:3682 | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O |
Safety and Handling
GHS H Statement:
Suspected of causing cancer.
GHS P Statement:
Use personal protective equipment as required.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
Warning
EINECSNumber : 204-173-5
RTECSNumber : CB6650000
TSCA : TSCA