missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,8-Dihydroxyanthraquinone, 95%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 114835000
Specifications
| 1, 8-Dihydroxyanthraquinone | |
| Authentic | |
| 1% max. | |
| Brown or Brown-Orange | |
| 500g | |
| 117-10-2 | |
| 100.0 | |
| C14H8O4 | |
| 08, 458 | |
| 1,8-dihydroxyanthraquinone, altan, antrapurol, chrysazin, danthron, dantron, diaquone, istizin, laxanorm, laxanthreen | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 1,8-dihydroxyanthracene-9,10-dione | |
| 2950 | |
| 240.21 | |
| 95% |
| >200°C | |
| Glass bottle | |
| 1% max. | |
| 190.0°C to 195.0°C | |
| 90-95% | |
| 90.0 | |
| 94% min. (HPLC) | |
| MFCD00001211 | |
| 15, 2814 | |
| Solubility in water: insoluble. Other solubilities: almost insoluble in alcohol,moderately soluble in ether,chloroform,soluble in 10 parts hot glacial acetic acid | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O | |
| 240.21 | |
| CHEBI:3682 | |
| Powder |
Chemical Identifiers
| 117-10-2 | |
| 240.21 | |
| QBPFLULOKWLNNW-UHFFFAOYSA-N | |
| 2950 | |
| 1,8-dihydroxyanthracene-9,10-dione |
| C14H8O4 | |
| MFCD00001211 | |
| 1,8-dihydroxyanthraquinone, altan, antrapurol, chrysazin, danthron, dantron, diaquone, istizin, laxanorm, laxanthreen | |
| CHEBI:3682 | |
| C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
Causes serious eye irritation.
GHS P Statement
Use personal protective equipment as required.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsing.
GHS Signal Word: Warning
EINECSNumber : 204-173-5
RTECSNumber : CB6650000
TSCA : TSCA