missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,8-Diaminooctane, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC112315000
Specifications
| 1, 8-Diaminooctane | |
| 115°C | |
| Glass bottle | |
| White to Yellow | |
| 500g | |
| 97.5 | |
| 97.5% min. (GC) | |
| H2N(CH2)8NH2 | |
| 04, 271 | |
| Solubility in water: 575g/L (20°C). | |
| [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] | |
| 217.18 | |
| CHEBI:73112 | |
| Solidified Crystalline Mass |
| 165g/mL | |
| Authentic | |
| 225.0°C to 226.0°C | |
| 50.0°C to 54.0°C | |
| 373-44-4 | |
| 100.0 | |
| C8H22Cl2N2 | |
| MFCD00008248 | |
| 1,8-diaminooctane, 1,8-octamethylenediamine, 1,8-octanediamine, 1,8-octylenediamine, alpha,omega-diaminooctane, chembl29392, diaminooctane, octamethylenediamine, octane 1,8-diamine, unii-53a6694pie | |
| ZFLWZOGXFQNIMT-UHFFFAOYSA-N | |
| octane-1,8-diamine | |
| 24250 | |
| 144.26 | |
| 98% |
Chemical Identifiers
| 373-44-4 | |
| 217.18 | |
| ZFLWZOGXFQNIMT-UHFFFAOYSA-N | |
| 24250 | |
| octane-1,8-diamine |
| C8H22Cl2N2 | |
| MFCD00008248 | |
| 1,8-diaminooctane, 1,8-octamethylenediamine, 1,8-octanediamine, 1,8-octylenediamine, alpha,omega-diaminooctane, chembl29392, diaminooctane, octamethylenediamine, octane 1,8-diamine, unii-53a6694pie | |
| CHEBI:73112 | |
| [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a POISON CENTER or doctor/physician.
Wear
GHS Signal Word: Danger
EINECSNumber : 206-764-3