missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,8-Diaminooctane, 98%, ACROS Organics™
$61.68 - $159.17
Chemical Identifiers
| CAS | 373-44-4 |
|---|---|
| Molecular Formula | C8H22Cl2N2 |
| Molecular Weight (g/mol) | 217.18 |
| MDL Number | MFCD00008248 |
| InChI Key | ZFLWZOGXFQNIMT-UHFFFAOYSA-N |
| Synonym | 1,8-diaminooctane, 1,8-octamethylenediamine, 1,8-octanediamine, 1,8-octylenediamine, alpha,omega-diaminooctane, chembl29392, diaminooctane, octamethylenediamine, octane 1,8-diamine, unii-53a6694pie |
| PubChem CID | 24250 |
| ChEBI | CHEBI:73112 |
| IUPAC Name | octane-1,8-bis(aminium) dichloride |
| SMILES | [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC112310250
|
Thermo Fisher Scientific
112310250 |
25g | Glass bottle |
Each for $61.68
|
|
AC112311000
|
Thermo Fisher Scientific
112311000 |
100g | Glass bottle |
Each for $159.17
|
|
AC112315000
|
Thermo Fisher Scientific
AC112315000 |
500g | Glass bottle |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 373-44-4 | |
| 217.18 | |
| ZFLWZOGXFQNIMT-UHFFFAOYSA-N | |
| 24250 | |
| octane-1,8-bis(aminium) dichloride |
| C8H22Cl2N2 | |
| MFCD00008248 | |
| 1,8-diaminooctane, 1,8-octamethylenediamine, 1,8-octanediamine, 1,8-octylenediamine, alpha,omega-diaminooctane, chembl29392, diaminooctane, octamethylenediamine, octane 1,8-diamine, unii-53a6694pie | |
| CHEBI:73112 | |
| [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] |
Specifications
| 165g/mL | |
| Authentic | |
| 225.0°C to 226.0°C | |
| 50.0°C to 54.0°C | |
| 373-44-4 | |
| 100.0 | |
| C8H22Cl2N2 | |
| MFCD00008248 | |
| 1,8-diaminooctane, 1,8-octamethylenediamine, 1,8-octanediamine, 1,8-octylenediamine, alpha,omega-diaminooctane, chembl29392, diaminooctane, octamethylenediamine, octane 1,8-diamine, unii-53a6694pie | |
| ZFLWZOGXFQNIMT-UHFFFAOYSA-N | |
| octane-1,8-bis(aminium) dichloride | |
| 24250 | |
| 144.26 | |
| 98% |
| 115°C | |
| Glass bottle | |
| White to Yellow | |
| 25g | |
| 97.5 | |
| 97.5% min. (GC) | |
| H2N(CH2)8NH2 | |
| 04, 271 | |
| Solubility in water: 575g/L (20°C). | |
| [Cl-].[Cl-].[NH3+]CCCCCCCC[NH3+] | |
| 217.18 | |
| CHEBI:73112 | |
| Solidified Crystalline Mass | |
| 1, 8-Diaminooctane |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Causes severe skin burns and eye damage.
May cause an allergic skin reaction.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
IF ON SKIN (or hair): Take off immediately all contaminated clothing.
Rinse skin with water/shower.
Immediately call a POISON CENTER or doctor/physician.
Wear
GHS Signal Word: Danger
EINECSNumber : 206-764-3