missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,3-Butanediol Dimethacrylate (stabilized with MEHQ) 98.0+%, TCI America™
Supplier: TCI America B106525ML
Specifications
| 1,3-Butanediol Dimethacrylate (stabilized with MEHQ) | |
| Colorless | |
| C12H18O4 | |
| 25 mL | |
| VDYWHVQKENANGY-UHFFFAOYSA-N | |
| 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate | |
| 70916 | |
| ≥98.0% (GC) |
| 1189-08-8 | |
| 290°C | |
| MFCD00014930 | |
| 1,3-Butylene Glycol Dimethacrylate | |
| CC(CCOC(=O)C(=C)C)OC(=O)C(=C)C | |
| 226.272 | |
| 226.27 | |
| Liquid |
Chemical Identifiers
| 1189-08-8 | |
| 226.272 | |
| VDYWHVQKENANGY-UHFFFAOYSA-N | |
| 70916 | |
| CC(CCOC(=O)C(=C)C)OC(=O)C(=C)C |
| C12H18O4 | |
| MFCD00014930 | |
| 1,3-Butylene Glycol Dimethacrylate | |
| 3-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (2)-0958&(2)-1058&(2)-1059
TSCA : Yes