missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-(3,5-Dichlorophenyl)-1H-pyrrole-2-carbaldehyde, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals CD08850DA
Specifications
| 1-(3, 5-Dichlorophenyl)-1H-pyrrole-2-carbaldehyde | |
| 96.5 | |
| 97% | |
| C11H7Cl2NO | |
| 1g | |
| GNBDQGBCNPLAQK-UHFFFAOYSA-N | |
| 1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde | |
| 2777016 | |
| 97% |
| 175136-79-5 | |
| 100.0 | |
| Amber Glass Bottle | |
| MFCD00174281 | |
| 1-3,5-dichlorophenyl-1h-pyrrole-2-carbaldehyde, 1-3,5-dichlorophenyl pyrrole-2-carbaldehyde, 1-3,5-dichlorophenyl-1h-pyrrole-2-carboxaldehyde, acmc-1c802, n-3,5-dichlorophenyl pyrrole-2-carboxaldehyde, 1-3,5-dichlorophenyl pyrrole-2-carboxaldehyde, 1-3,5-dichloro-phenyl-1h-pyrrole-2-carbald ehyde, 1h-pyrrole-2-carboxaldehyde,1-3,5-dichlorophenyl | |
| ClC1=CC(=CC(Cl)=C1)N1C=CC=C1C=O | |
| 240.08 | |
| 240.09 |
Chemical Identifiers
| 175136-79-5 | |
| 240.08 | |
| GNBDQGBCNPLAQK-UHFFFAOYSA-N | |
| 2777016 | |
| ClC1=CC(=CC(Cl)=C1)N1C=CC=C1C=O |
| C11H7Cl2NO | |
| MFCD00174281 | |
| 1-3,5-dichlorophenyl-1h-pyrrole-2-carbaldehyde, 1-3,5-dichlorophenyl pyrrole-2-carbaldehyde, 1-3,5-dichlorophenyl-1h-pyrrole-2-carboxaldehyde, acmc-1c802, n-3,5-dichlorophenyl pyrrole-2-carboxaldehyde, 1-3,5-dichlorophenyl pyrrole-2-carboxaldehyde, 1-3,5-dichloro-phenyl-1h-pyrrole-2-carbald ehyde, 1h-pyrrole-2-carboxaldehyde,1-3,5-dichlorophenyl | |
| 1-(3,5-dichlorophenyl)-1H-pyrrole-2-carbaldehyde |