missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-(2-Phenyl-1,3-thiazol-4-yl)ethan-1-one, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals SPB03431EA
Specifications
| 1-(2-Phenyl-1, 3-thiazol-4-yl)ethan-1-one | |
| 95.0 | |
| C11H9NOS | |
| 10g | |
| ZOOGZFPRAKXWKI-UHFFFAOYSA-N | |
| 1-(2-phenyl-1,3-thiazol-4-yl)ethanone | |
| 604819 | |
| 95% |
| 10045-52-0 | |
| 95% | |
| MFCD00068112 | |
| 1-2-phenylthiazol-4-yl ethanone, 1-2-phenyl-1,3-thiazol-4-yl ethan-1-one, 1-2-phenyl-1,3-thiazol-4-yl ethanone, 4-acetyl-2-phenylthiazole, 1-2-phenyl-1,3-thiazol-4-yl-1-ethanone, ethanone, 1-2-phenyl-4-thiazolyl, 4-acetyl-2-phenyl-1,3-thiazole, maybridge1_008631, buttpark 15357-18, 2-phenyl-4-acetylthiazole | |
| CC(=O)C1=CSC(=N1)C2=CC=CC=C2 | |
| 203.259 | |
| 203.26 |
Chemical Identifiers
| 10045-52-0 | |
| 203.259 | |
| ZOOGZFPRAKXWKI-UHFFFAOYSA-N | |
| 604819 | |
| CC(=O)C1=CSC(=N1)C2=CC=CC=C2 |
| C11H9NOS | |
| MFCD00068112 | |
| 1-2-phenylthiazol-4-yl ethanone, 1-2-phenyl-1,3-thiazol-4-yl ethan-1-one, 1-2-phenyl-1,3-thiazol-4-yl ethanone, 4-acetyl-2-phenylthiazole, 1-2-phenyl-1,3-thiazol-4-yl-1-ethanone, ethanone, 1-2-phenyl-4-thiazolyl, 4-acetyl-2-phenyl-1,3-thiazole, maybridge1_008631, buttpark 15357-18, 2-phenyl-4-acetylthiazole | |
| 1-(2-phenyl-1,3-thiazol-4-yl)ethanone |