missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-(2-Aminoethyl)-2-methyl-5-nitroimidazole dihydrochloride monohydrate, 98%, ACROS Organics™
Chemical Identifiers
| CAS | 49575-10-2 |
|---|---|
| Molecular Formula | 2HCl·H2O |
| Molecular Weight (g/mol) | 261.11 |
| MDL Number | MFCD00066965 |
| InChI Key | AZYQXHDJVHNBRE-UHFFFAOYSA-N |
| Synonym | dihydrogen 2-2-methyl-5-nitroimidazol-1-yl ethanamine hydrate dichloride |
| PubChem CID | 12222573 |
| IUPAC Name | 2-(2-methyl-5-nitroimidazol-1-yl)ethanamine;dihydrochloride |
| SMILES | CC1=NC=C(N1CCN)[N+](=O)[O-].Cl.Cl |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AC213030050
|
Thermo Fisher Scientific
213030050 |
5g | N/A | N/A | |||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 49575-10-2 | |
| 261.11 | |
| AZYQXHDJVHNBRE-UHFFFAOYSA-N | |
| 12222573 | |
| CC1=NC=C(N1CCN)[N+](=O)[O-].Cl.Cl |
| 2HCl·H2O | |
| MFCD00066965 | |
| dihydrogen 2-2-methyl-5-nitroimidazol-1-yl ethanamine hydrate dichloride | |
| 2-(2-methyl-5-nitroimidazol-1-yl)ethanamine;dihydrochloride |
Specifications
| Glass bottle | |
| 5g | |
| 97.5 | |
| 98% | |
| MFCD00066965 | |
| Solubility in water: 600g/L. Other solubilities: methanol:26g/L ethanol:1.8g/L 2-propanol:0.48g/l,dichloromethane: 0.11g/L,acetone: 0.11g/L,n,n-dimethylformamide: 7g/L | |
| CC1=NC=C(N1CCN)[N+](=O)[O-].Cl.Cl | |
| 261.11 | |
| 261.11 | |
| 1-(2-Aminoethyl)-2-methyl-5-nitroimidazole dihydrochloride monohydrate, 98% |
| 195°C | |
| 49575-10-2 | |
| 100.0 | |
| 2HCl·H2O | |
| dihydrogen 2-2-methyl-5-nitroimidazol-1-yl ethanamine hydrate dichloride | |
| AZYQXHDJVHNBRE-UHFFFAOYSA-N | |
| 2-(2-methyl-5-nitroimidazol-1-yl)ethanamine;dihydrochloride | |
| 12222573 | |
| 98% |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
Harmful if swallowed.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
Obtain special instructions before use.
GHS Signal Word: Warning
EINECSNumber : 256-385-2
TSCA : TSCA