missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,1-Diphenylethylene, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117261000
Specifications
1, 1-Diphenylethylene | |
>112°C | |
Glass bottle | |
1.02 | |
Colorless | |
100g | |
97.5 | |
97.5% min. (GC) | |
(C6H5)2C=CH2 | |
15,3356 | |
ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
1-phenylethenylbenzene | |
10740 | |
Liquid |
1.0200g/mL | |
Authentic | |
1.6065 to 1.6085 | |
270.0°C to 271.0°C | |
6.0°C | |
530-48-3 | |
100.0 | |
C14H12 | |
05,639 | |
.alpha.-phenylstyrene, 1,1-diphenylethene, 1,1-diphenylethylene, 1-phenylethenyl benzene, 1-phenylvinyl benzene, as-diphenylethylene, benzene, 1,1'-ethenylidenebis, bx0l5b6lll, ethene-1,1-diyldibenzene, unii-bx0l5b6lll | |
C=C(C1=CC=CC=C1)C2=CC=CC=C2 | |
180.25 | |
180.25 | |
98% |
Chemical Identifiers
530-48-3 | |
180.25 | |
.alpha.-phenylstyrene, 1,1-diphenylethene, 1,1-diphenylethylene, 1-phenylethenyl benzene, 1-phenylvinyl benzene, as-diphenylethylene, benzene, 1,1'-ethenylidenebis, bx0l5b6lll, ethene-1,1-diyldibenzene, unii-bx0l5b6lll | |
1-phenylethenylbenzene |
C14H12 | |
ZMYIIHDQURVDRB-UHFFFAOYSA-N | |
10740 | |
C=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Safety and Handling
EINECSNumber : 208-482-6