Learn More
1,1'-Bi-2-naphthol, 99%, ACROS Organics™
$40.83 - $121.71
Chemical Identifiers
| CAS | 602-09-5 |
|---|---|
| Molecular Formula | C20H14O2 |
| Molecular Weight (g/mol) | 286.32 |
| MDL Number | MFCD00004068 |
| InChI Key | PPTXVXKCQZKFBN-UHFFFAOYSA-N |
| Synonym | 1,1'-bi-2-naphthol, 1,1'-binaphthalene-2,2'-diol, 1,1'-binaphthyl-2,2'-diol, 2,2'-dinaphthol, beta-binaphthol, binol, r-+-1,1'-bi-2-naphthol, r-1,1'-bi-2-naphthol, s---1,1'-bi-2-naphthol, s-1,1'-binaphthalene-2,2'-diol |
| PubChem CID | 11762 |
| IUPAC Name | 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC147350050
|
Thermo Fisher Scientific
AC147350050 |
5g | Glass bottle |
Each for $40.83
|
|
AC147350250
|
Thermo Fisher Scientific
147350250 |
25g | Glass bottle |
Each for $121.71
|
|
Chemical Identifiers
| 602-09-5 | |
| 286.32 | |
| PPTXVXKCQZKFBN-UHFFFAOYSA-N | |
| 11762 | |
| C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O |
| C20H14O2 | |
| MFCD00004068 | |
| 1,1'-bi-2-naphthol, 1,1'-binaphthalene-2,2'-diol, 1,1'-binaphthyl-2,2'-diol, 2,2'-dinaphthol, beta-binaphthol, binol, r-+-1,1'-bi-2-naphthol, r-1,1'-bi-2-naphthol, s---1,1'-bi-2-naphthol, s-1,1'-binaphthalene-2,2'-diol | |
| 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
Specifications
| Authentic | |
| White to Beige | |
| 5g | |
| 98.5 | |
| 99% | |
| HOC10H6C10H6OH | |
| 06, 1051 | |
| 15, 1230 | |
| Solubility in water: insoluble. Other solubilities: slightly soluble in acetone and ethanol | |
| C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)O)O | |
| 286.32 | |
| 286.32 | |
| 99% |
| Glass bottle | |
| 215°C to 218°C | |
| 602-09-5 | |
| 100.0 | |
| C20H14O2 | |
| MFCD00004068 | |
| 15,26; 16,24 | |
| 1,1'-bi-2-naphthol, 1,1'-binaphthalene-2,2'-diol, 1,1'-binaphthyl-2,2'-diol, 2,2'-dinaphthol, beta-binaphthol, binol, r-+-1,1'-bi-2-naphthol, r-1,1'-bi-2-naphthol, s---1,1'-bi-2-naphthol, s-1,1'-binaphthalene-2,2'-diol | |
| PPTXVXKCQZKFBN-UHFFFAOYSA-N | |
| 1-(2-hydroxynaphthalen-1-yl)naphthalen-2-ol | |
| 11762 | |
| Powder | |
| 1, 1'-Bi-2-naphthol, 99% |
Safety and Handling
GHS H Statement:
Causes skin irritation.
Toxic if swallowed.
May cause respiratory irritation.
Causes serious eye irritation.
GHS P Statement:
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Danger
EINECSNumber : 210-014-0
RTECSNumber : DU3106000
TSCA : TSCA