missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
DL-Histidine hydrochloride, monohydrate, 98%, Thermo Scientific Chemicals
$418.41 - $418.41
Chemical Identifiers
| CAS | 123333-71-1 |
|---|---|
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight (g/mol) | 191.62 |
| MDL Number | MFCD00064555 |
| InChI Key | QZNNVYOVQUKYSC-JEDNCBNOSA-N |
| Synonym | hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride |
| PubChem CID | 53395185 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride |
| SMILES | [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC411721000
|
Thermo Scientific Chemicals
411721000 |
100 g | Glass Bottle |
Each for $418.41
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 123333-71-1 | |
| 191.62 | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 53395185 | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride |
Specifications
| 233.0°C | |
| 1ppm max. | |
| 10ppm max. | |
| C6H10ClN3O2 | |
| MFCD00064555 | |
| 1% max. | |
| Glass Bottle | |
| QZNNVYOVQUKYSC-JEDNCBNOSA-N | |
| 2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydron;chloride | |
| 53395185 | |
| 96% min. (c=3, H2O, 430nm) 1cm cell | |
| 98% | |
| 100 g | |
| DL-Histidine hydrochloride, monohydrate, 98% |
| 123333-71-1 | |
| White | |
| 98% | |
| Authentic | |
| 10ppm max. | |
| (TLC) none | |
| hydrogen dl-histidine chloride, 2-amino-3-1h-imidazol-5-yl propanoic acid; hydron; chloride, 2-azanyl-3-1h-imidazol-5-yl propanoic acid; hydron; chloride | |
| [H+].[Cl-].N[C@@H](CC1=CN=CN1)C(O)=O | |
| 191.62 | |
| 300ppm max. | |
| 209.64 | |
| 0.1% max. | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : 229-266-8
TSCA : TSCA
RUO – Research Use Only